C10H16N4 — CID 165134076
(Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine (PubChem CID 165134076) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine.
| Compound Name | (Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine |
|---|---|
| PubChem CID | 165134076 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine |
| SMILES | C/C=C\n1nc(C(C)C)nc1/N=C\C |
| InChI | InChI=1S/C10H16N4/c1-5-7-14-10(11-6-2)12-9(13-14)8(3)4/h5-8H,1-4H3/b7-5-,11-6- |
| InChIKey | ONNTVVYSNVWRNG-JMPJYAQRSA-N |
| XLogP | 2.61 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|