About 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one
4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one (PubChem CID 161109212) has the molecular formula C14H15IN4O2
and a molecular weight of 398.20 g/mol. Its IUPAC name is 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one.
Molecular Properties
| Compound Name | 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one |
| PubChem CID | 161109212 |
| Molecular Formula | C14H15IN4O2 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one |
| SMILES | CC=C/C=C(\C)OCc1c(I)cccc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C14H15IN4O2/c1-3-4-6-10(2)21-9-11-12(15)7-5-8-13(11)19-14(20)16-17-18-19/h3-8H,9H2,1-2H3,(H,16,18,20)/b4-3?,10-6+ |
| InChIKey | KMBRPWJQHKWTNU-SQZOSTRESA-N |
| XLogP | 2.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one?
The IUPAC name of 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one (CID 161109212) is 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one.
What is the SMILES notation for 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one?
The canonical SMILES for 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one is CC=C/C=C(\C)OCc1c(I)cccc1-n1nn[nH]c1=O.
What is the InChIKey of 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one?
The InChIKey is KMBRPWJQHKWTNU-SQZOSTRESA-N. The full InChI is InChI=1S/C14H15IN4O2/c1-3-4-6-10(2)21-9-11-12(15)7-5-8-13(11)19-14(20)16-17-18-19/h3-8H,9H2,1-2H3,(H,16,18,20)/b4-3?,10-6+.
What are the key properties of 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one?
4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one has a molecular weight of 398.20 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[(2E)-hexa-2,4-dien-2-yl]oxymethyl]-3-iodophenyl]-1H-tetrazol-5-one is sourced from PubChem (CID 161109212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).