C16H18F3N3O2 — CID 161131324
N-(oxan-4-yl)-3-[3-(trifluoromethyl)phenyl]-2H-imidazole-1-carboxamide (PubChem CID 161131324) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-(oxan-4-yl)-3-[3-(trifluoromethyl)phenyl]-2H-imidazole-1-carboxamide.
| Compound Name | N-(oxan-4-yl)-3-[3-(trifluoromethyl)phenyl]-2H-imidazole-1-carboxamide |
|---|---|
| PubChem CID | 161131324 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(oxan-4-yl)-3-[3-(trifluoromethyl)phenyl]-2H-imidazole-1-carboxamide |
| SMILES | O=C(NC1CCOCC1)N1C=CN(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)12-2-1-3-14(10-12)21-6-7-22(11-21)15(23)20-13-4-8-24-9-5-13/h1-3,6-7,10,13H,4-5,8-9,11H2,(H,20,23) |
| InChIKey | UMFOARAIBYQIGO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |