C6H11NS — CID 161133287
3,5-dimethyl-1,2-thiazole;methane (PubChem CID 161133287) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-thiazole;methane.
| Compound Name | 3,5-dimethyl-1,2-thiazole;methane |
|---|---|
| PubChem CID | 161133287 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3,5-dimethyl-1,2-thiazole;methane |
| SMILES | C.Cc1cc(C)sn1 |
| InChI | InChI=1S/C5H7NS.CH4/c1-4-3-5(2)7-6-4;/h3H,1-2H3;1H4 |
| InChIKey | UMLZQMXSIQGPJS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |