C14H18N2O4S — CID 161136369
N-[3-[[2-(oxolan-3-yl)acetyl]amino]oxetan-3-yl]thiophene-2-carboxamide (PubChem CID 161136369) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[3-[[2-(oxolan-3-yl)acetyl]amino]oxetan-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(oxolan-3-yl)acetyl]amino]oxetan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 161136369 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[3-[[2-(oxolan-3-yl)acetyl]amino]oxetan-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(CC1CCOC1)NC1(NC(=O)c2cccs2)COC1 |
| InChI | InChI=1S/C14H18N2O4S/c17-12(6-10-3-4-19-7-10)15-14(8-20-9-14)16-13(18)11-2-1-5-21-11/h1-2,5,10H,3-4,6-9H2,(H,15,17)(H,16,18) |
| InChIKey | UMVURECSQLWXJH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|