About methane;[(E)-2-phenylethenyl]boronic acid
methane;[(E)-2-phenylethenyl]boronic acid (PubChem CID 161139554) has the molecular formula C9H13BO2
and a molecular weight of 164.01 g/mol. Its IUPAC name is methane;[(E)-2-phenylethenyl]boronic acid.
Molecular Properties
| Compound Name | methane;[(E)-2-phenylethenyl]boronic acid |
| PubChem CID | 161139554 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.01 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | methane;[(E)-2-phenylethenyl]boronic acid |
| SMILES | C.OB(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C8H9BO2.CH4/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-7,10-11H;1H4/b7-6+; |
| InChIKey | UNGFEWWYDNAQHY-UHDJGPCESA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.01 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methane;[(E)-2-phenylethenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(E)-2-phenylethenyl]boronic acid?
The IUPAC name of methane;[(E)-2-phenylethenyl]boronic acid (CID 161139554) is methane;[(E)-2-phenylethenyl]boronic acid.
What is the SMILES notation for methane;[(E)-2-phenylethenyl]boronic acid?
The canonical SMILES for methane;[(E)-2-phenylethenyl]boronic acid is C.OB(O)/C=C/c1ccccc1.
What is the InChIKey of methane;[(E)-2-phenylethenyl]boronic acid?
The InChIKey is UNGFEWWYDNAQHY-UHDJGPCESA-N. The full InChI is InChI=1S/C8H9BO2.CH4/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-7,10-11H;1H4/b7-6+;.
What are the key properties of methane;[(E)-2-phenylethenyl]boronic acid?
methane;[(E)-2-phenylethenyl]boronic acid has a molecular weight of 164.01 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(E)-2-phenylethenyl]boronic acid is sourced from PubChem (CID 161139554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).