C24H9ClN8O10 — CID 161140943
1-chloro-2,4-diisocyanatobenzene;1,4-diisocyanato-2-nitrobenzene;2,4-diisocyanato-1-nitrobenzene (PubChem CID 161140943) has the molecular formula C24H9ClN8O10 and a molecular weight of 604.84 g/mol. Its IUPAC name is 1-chloro-2,4-diisocyanatobenzene;1,4-diisocyanato-2-nitrobenzene;2,4-diisocyanato-1-nitrobenzene.
| Compound Name | 1-chloro-2,4-diisocyanatobenzene;1,4-diisocyanato-2-nitrobenzene;2,4-diisocyanato-1-nitrobenzene |
|---|---|
| PubChem CID | 161140943 |
| Molecular Formula | C24H9ClN8O10 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.01 |
| IUPAC Name | 1-chloro-2,4-diisocyanatobenzene;1,4-diisocyanato-2-nitrobenzene;2,4-diisocyanato-1-nitrobenzene |
| SMILES | O=C=Nc1ccc(Cl)c(N=C=O)c1.O=C=Nc1ccc(N=C=O)c([N+](=O)[O-])c1.O=C=Nc1ccc([N+](=O)[O-])c(N=C=O)c1 |
| InChI | InChI=1S/C8H3ClN2O2.2C8H3N3O4/c9-7-2-1-6(10-4-12)3-8(7)11-5-13;12-4-9-6-1-2-8(11(14)15)7(3-6)10-5-13;12-4-9-6-1-2-7(10-5-13)8(3-6)11(14)15/h1-3H;2*1-3H |
| InChIKey | UNKYDZABGXPVGB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 262.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|