C20H14N4O3S — CID 161147444
5-phenyl-6-(2-pyridin-2-ylphenyl)-1,2,4-triazine-3-sulfonic acid (PubChem CID 161147444) has the molecular formula C20H14N4O3S and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-phenyl-6-(2-pyridin-2-ylphenyl)-1,2,4-triazine-3-sulfonic acid.
| Compound Name | 5-phenyl-6-(2-pyridin-2-ylphenyl)-1,2,4-triazine-3-sulfonic acid |
|---|---|
| PubChem CID | 161147444 |
| Molecular Formula | C20H14N4O3S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-phenyl-6-(2-pyridin-2-ylphenyl)-1,2,4-triazine-3-sulfonic acid |
| SMILES | O=S(=O)(O)c1nnc(-c2ccccc2-c2ccccn2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H14N4O3S/c25-28(26,27)20-22-18(14-8-2-1-3-9-14)19(23-24-20)16-11-5-4-10-15(16)17-12-6-7-13-21-17/h1-13H,(H,25,26,27) |
| InChIKey | IXVFKLUQEUZOOG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|