C8H11N2O2PS2 — CID 161149296
N'-dihydroxyphosphinothioyl-N-(4-methylsulfanylphenyl)methanimidamide (PubChem CID 161149296) has the molecular formula C8H11N2O2PS2 and a molecular weight of 262.30 g/mol. Its IUPAC name is N'-dihydroxyphosphinothioyl-N-(4-methylsulfanylphenyl)methanimidamide.
| Compound Name | N'-dihydroxyphosphinothioyl-N-(4-methylsulfanylphenyl)methanimidamide |
|---|---|
| PubChem CID | 161149296 |
| Molecular Formula | C8H11N2O2PS2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | N'-dihydroxyphosphinothioyl-N-(4-methylsulfanylphenyl)methanimidamide |
| SMILES | CSc1ccc(NC=NP(O)(O)=S)cc1 |
| InChI | InChI=1S/C8H11N2O2PS2/c1-15-8-4-2-7(3-5-8)9-6-10-13(11,12)14/h2-6H,1H3,(H3,9,10,11,12,14) |
| InChIKey | UOLNYWYKPZXBLL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|