C19H20N2S2 — CID 74935118
4-methylsulfanyl-N-[5-(4-methylsulfanylphenyl)iminopenta-1,3-dienyl]aniline (PubChem CID 74935118) has the molecular formula C19H20N2S2 and a molecular weight of 340.52 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[5-(4-methylsulfanylphenyl)iminopenta-1,3-dienyl]aniline.
| Compound Name | 4-methylsulfanyl-N-[5-(4-methylsulfanylphenyl)iminopenta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 74935118 |
| Molecular Formula | C19H20N2S2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-methylsulfanyl-N-[5-(4-methylsulfanylphenyl)iminopenta-1,3-dienyl]aniline |
| SMILES | CSc1ccc(/N=C/C=CC=CNc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C19H20N2S2/c1-22-18-10-6-16(7-11-18)20-14-4-3-5-15-21-17-8-12-19(23-2)13-9-17/h3-15,20H,1-2H3/b5-3?,14-4?,21-15+ |
| InChIKey | XPKUGUKJYXWUMK-VMJLTXDHSA-N |
| XLogP | 6.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|