C21H24N2O4S — CID 161158270
N-[2-(3,3-dimethylbutoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 161158270) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[2-(3,3-dimethylbutoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-[2-(3,3-dimethylbutoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 161158270 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[2-(3,3-dimethylbutoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | CC(C)(C)CCOc1ccccc1NS(=O)(=O)c1ccc2[nH]c(=O)ccc2c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-21(2,3)12-13-27-19-7-5-4-6-18(19)23-28(25,26)16-9-10-17-15(14-16)8-11-20(24)22-17/h4-11,14,23H,12-13H2,1-3H3,(H,22,24) |
| InChIKey | UPOVEDRAKLYTBF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |