C22H26N2O4S — CID 166688873
N-[2-(3,3-dimethylpentoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 166688873) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[2-(3,3-dimethylpentoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-[2-(3,3-dimethylpentoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 166688873 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[2-(3,3-dimethylpentoxy)phenyl]-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | CCC(C)(C)CCOc1ccccc1NS(=O)(=O)c1ccc2[nH]c(=O)ccc2c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-4-22(2,3)13-14-28-20-8-6-5-7-19(20)24-29(26,27)17-10-11-18-16(15-17)9-12-21(25)23-18/h5-12,15,24H,4,13-14H2,1-3H3,(H,23,25) |
| InChIKey | HMRDJSRKCMTZDE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |