C17H13Cl2F3N4OS — CID 161170927
9-chloro-5-(chloromethyl)-5-ethenyl-3-ethylsulfinyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline (PubChem CID 161170927) has the molecular formula C17H13Cl2F3N4OS and a molecular weight of 449.29 g/mol. Its IUPAC name is 9-chloro-5-(chloromethyl)-5-ethenyl-3-ethylsulfinyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline.
| Compound Name | 9-chloro-5-(chloromethyl)-5-ethenyl-3-ethylsulfinyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline |
|---|---|
| PubChem CID | 161170927 |
| Molecular Formula | C17H13Cl2F3N4OS |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 9-chloro-5-(chloromethyl)-5-ethenyl-3-ethylsulfinyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline |
| SMILES | [C-]#[N+]c1nn2c(c1S(=O)CC)NC(C=C)(CCl)c1cc(C(F)(F)F)cc(Cl)c1-2 |
| InChI | InChI=1S/C17H13Cl2F3N4OS/c1-4-16(8-18)10-6-9(17(20,21)22)7-11(19)12(10)26-15(24-16)13(28(27)5-2)14(23-3)25-26/h4,6-7,24H,1,5,8H2,2H3 |
| InChIKey | URDWZFDOMOTENV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|