C15H8BrCl2F3N4 — CID 162257850
3-bromo-9-chloro-5-(chloromethyl)-5-ethenyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline (PubChem CID 162257850) has the molecular formula C15H8BrCl2F3N4 and a molecular weight of 452.06 g/mol. Its IUPAC name is 3-bromo-9-chloro-5-(chloromethyl)-5-ethenyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline.
| Compound Name | 3-bromo-9-chloro-5-(chloromethyl)-5-ethenyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline |
|---|---|
| PubChem CID | 162257850 |
| Molecular Formula | C15H8BrCl2F3N4 |
| Molecular Weight | 452.06 g/mol |
| Exact Mass | 449.93 |
| IUPAC Name | 3-bromo-9-chloro-5-(chloromethyl)-5-ethenyl-2-isocyano-7-(trifluoromethyl)-4H-pyrazolo[1,5-a]quinazoline |
| SMILES | [C-]#[N+]c1nn2c(c1Br)NC(C=C)(CCl)c1cc(C(F)(F)F)cc(Cl)c1-2 |
| InChI | InChI=1S/C15H8BrCl2F3N4/c1-3-14(6-17)8-4-7(15(19,20)21)5-9(18)11(8)25-13(23-14)10(16)12(22-2)24-25/h3-5,23H,1,6H2 |
| InChIKey | ZYVKBDWCGCJZTR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.06 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|