C12H7Cl2F3N4 — CID 20717097
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(isocyanomethyl)pyrazol-5-amine (PubChem CID 20717097) has the molecular formula C12H7Cl2F3N4 and a molecular weight of 335.12 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(isocyanomethyl)pyrazol-5-amine.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(isocyanomethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 20717097 |
| Molecular Formula | C12H7Cl2F3N4 |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-(isocyanomethyl)pyrazol-5-amine |
| SMILES | [C-]#[N+]Cc1cc(N)n(-c2c(Cl)cc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C12H7Cl2F3N4/c1-19-5-7-4-10(18)21(20-7)11-8(13)2-6(3-9(11)14)12(15,16)17/h2-4H,5,18H2 |
| InChIKey | XUXVQZWVESYSOT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|