About 2-ethylhexyl carbamodithioate;iron
2-ethylhexyl carbamodithioate;iron (PubChem CID 161170944) has the molecular formula C9H19FeNS2
and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-ethylhexyl carbamodithioate;iron.
Molecular Properties
| Compound Name | 2-ethylhexyl carbamodithioate;iron |
| PubChem CID | 161170944 |
| Molecular Formula | C9H19FeNS2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-ethylhexyl carbamodithioate;iron |
| SMILES | CCCCC(CC)CSC(N)=S.[Fe] |
| InChI | InChI=1S/C9H19NS2.Fe/c1-3-5-6-8(4-2)7-12-9(10)11;/h8H,3-7H2,1-2H3,(H2,10,11); |
| InChIKey | URDZGDMDRWXSPJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl carbamodithioate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl carbamodithioate;iron?
The IUPAC name of 2-ethylhexyl carbamodithioate;iron (CID 161170944) is 2-ethylhexyl carbamodithioate;iron.
What is the SMILES notation for 2-ethylhexyl carbamodithioate;iron?
The canonical SMILES for 2-ethylhexyl carbamodithioate;iron is CCCCC(CC)CSC(N)=S.[Fe].
What is the InChIKey of 2-ethylhexyl carbamodithioate;iron?
The InChIKey is URDZGDMDRWXSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2.Fe/c1-3-5-6-8(4-2)7-12-9(10)11;/h8H,3-7H2,1-2H3,(H2,10,11);.
What are the key properties of 2-ethylhexyl carbamodithioate;iron?
2-ethylhexyl carbamodithioate;iron has a molecular weight of 261.24 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl carbamodithioate;iron is sourced from PubChem (CID 161170944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).