C20H34N2S2 — CID 123201122
2,3-bis(2-ethylhexylsulfanyl)but-2-enedinitrile (PubChem CID 123201122) has the molecular formula C20H34N2S2 and a molecular weight of 366.64 g/mol. Its IUPAC name is 2,3-bis(2-ethylhexylsulfanyl)but-2-enedinitrile.
| Compound Name | 2,3-bis(2-ethylhexylsulfanyl)but-2-enedinitrile |
|---|---|
| PubChem CID | 123201122 |
| Molecular Formula | C20H34N2S2 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2,3-bis(2-ethylhexylsulfanyl)but-2-enedinitrile |
| SMILES | CCCCC(CC)CSC(C#N)=C(C#N)SCC(CC)CCCC |
| InChI | InChI=1S/C20H34N2S2/c1-5-9-11-17(7-3)15-23-19(13-21)20(14-22)24-16-18(8-4)12-10-6-2/h17-18H,5-12,15-16H2,1-4H3 |
| InChIKey | VPHDVHOVWXTJDG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|