About 2-ethylhexyl N-methylethanimidothioate
2-ethylhexyl N-methylethanimidothioate (PubChem CID 155392215) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 2-ethylhexyl N-methylethanimidothioate.
Molecular Properties
| Compound Name | 2-ethylhexyl N-methylethanimidothioate |
| PubChem CID | 155392215 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 2-ethylhexyl N-methylethanimidothioate |
| SMILES | CCCCC(CC)CS/C(C)=N/C |
| InChI | InChI=1S/C11H23NS/c1-5-7-8-11(6-2)9-13-10(3)12-4/h11H,5-9H2,1-4H3/b12-10+ |
| InChIKey | MNVPMMRQEDZKTA-ZRDIBKRKSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl N-methylethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl N-methylethanimidothioate?
The IUPAC name of 2-ethylhexyl N-methylethanimidothioate (CID 155392215) is 2-ethylhexyl N-methylethanimidothioate.
What is the SMILES notation for 2-ethylhexyl N-methylethanimidothioate?
The canonical SMILES for 2-ethylhexyl N-methylethanimidothioate is CCCCC(CC)CS/C(C)=N/C.
What is the InChIKey of 2-ethylhexyl N-methylethanimidothioate?
The InChIKey is MNVPMMRQEDZKTA-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H23NS/c1-5-7-8-11(6-2)9-13-10(3)12-4/h11H,5-9H2,1-4H3/b12-10+.
What are the key properties of 2-ethylhexyl N-methylethanimidothioate?
2-ethylhexyl N-methylethanimidothioate has a molecular weight of 201.38 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl N-methylethanimidothioate is sourced from PubChem (CID 155392215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).