About [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium
[dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium (PubChem CID 172731992) has the molecular formula C12H28O2PS2+
and a molecular weight of 299.46 g/mol. Its IUPAC name is [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium.
Molecular Properties
| Compound Name | [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium |
| PubChem CID | 172731992 |
| Molecular Formula | C12H28O2PS2+ |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium |
| SMILES | CCCCC(CC)C[S+]=P(O)(O)SCC(C)C |
| InChI | InChI=1S/C12H28O2PS2/c1-5-7-8-12(6-2)10-17-15(13,14)16-9-11(3)4/h11-14H,5-10H2,1-4H3/q+1 |
| InChIKey | VHSMNYGEYZVMCD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium?
The IUPAC name of [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium (CID 172731992) is [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium.
What is the SMILES notation for [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium?
The canonical SMILES for [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium is CCCCC(CC)C[S+]=P(O)(O)SCC(C)C.
What is the InChIKey of [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium?
The InChIKey is VHSMNYGEYZVMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O2PS2/c1-5-7-8-12(6-2)10-17-15(13,14)16-9-11(3)4/h11-14H,5-10H2,1-4H3/q+1.
What are the key properties of [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium?
[dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium has a molecular weight of 299.46 g/mol, XLogP of 4.34, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [dihydroxy(2-methylpropylsulfanyl)-λ5-phosphanylidene]-(2-ethylhexyl)sulfanium is sourced from PubChem (CID 172731992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).