C11H10BrF3N4O2 — CID 161172584
5-bromo-N-methoxy-N-methyl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine (PubChem CID 161172584) has the molecular formula C11H10BrF3N4O2 and a molecular weight of 367.13 g/mol. Its IUPAC name is 5-bromo-N-methoxy-N-methyl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine.
| Compound Name | 5-bromo-N-methoxy-N-methyl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 161172584 |
| Molecular Formula | C11H10BrF3N4O2 |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 5-bromo-N-methoxy-N-methyl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
| SMILES | CON(C)c1nc(Br)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10BrF3N4O2/c1-18(20-2)10-16-9(12)17-19(10)7-3-5-8(6-4-7)21-11(13,14)15/h3-6H,1-2H3 |
| InChIKey | URJOEQNUOVFRTQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|