C17H10BrF3N2O2 — CID 138585561
4-bromo-7-ethenyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one (PubChem CID 138585561) has the molecular formula C17H10BrF3N2O2 and a molecular weight of 411.18 g/mol. Its IUPAC name is 4-bromo-7-ethenyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one.
| Compound Name | 4-bromo-7-ethenyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one |
|---|---|
| PubChem CID | 138585561 |
| Molecular Formula | C17H10BrF3N2O2 |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 4-bromo-7-ethenyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one |
| SMILES | C=Cc1ccc2c(Br)nn(-c3ccc(OC(F)(F)F)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C17H10BrF3N2O2/c1-2-10-3-8-13-14(9-10)16(24)23(22-15(13)18)11-4-6-12(7-5-11)25-17(19,20)21/h2-9H,1H2 |
| InChIKey | GOZUIZZJXKOQMU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |