C17H13F3N4O2 — CID 169173121
N-[3-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide (PubChem CID 169173121) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[3-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide.
| Compound Name | N-[3-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 169173121 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[3-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc2c(c1)c(C)nn2-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N4O2/c1-3-15(25)22-11-8-14-10(2)23-24(16(14)21-9-11)12-4-6-13(7-5-12)26-17(18,19)20/h3-9H,1H2,2H3,(H,22,25) |
| InChIKey | GUHSGZUADNCVSV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|