C17H14Cl2N4O — CID 169173142
N-[1-(4,5-dichloro-2-methylphenyl)-3-methylpyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide (PubChem CID 169173142) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is N-[1-(4,5-dichloro-2-methylphenyl)-3-methylpyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide.
| Compound Name | N-[1-(4,5-dichloro-2-methylphenyl)-3-methylpyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 169173142 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[1-(4,5-dichloro-2-methylphenyl)-3-methylpyrazolo[5,4-b]pyridin-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc2c(c1)c(C)nn2-c1cc(Cl)c(Cl)cc1C |
| InChI | InChI=1S/C17H14Cl2N4O/c1-4-16(24)21-11-6-12-10(3)22-23(17(12)20-8-11)15-7-14(19)13(18)5-9(15)2/h4-8H,1H2,2-3H3,(H,21,24) |
| InChIKey | BUHMFZIULFGBEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|