C44H38N2+2 — CID 161175068
5,21-ditert-butylspiro[2,24-diazoniaheptacyclo[12.10.1.11,8.02,7.018,25.019,24.012,26]hexacosa-2(7),3,5,8(26),9,11,14,16,18(25),19(24),20,22-dodecaene-13,9'-fluorene] (PubChem CID 161175068) has the molecular formula C44H38N2+2 and a molecular weight of 594.80 g/mol. Its IUPAC name is 5,21-ditert-butylspiro[2,24-diazoniaheptacyclo[12.10.1.11,8.02,7.018,25.019,24.012,26]hexacosa-2(7),3,5,8(26),9,11,14,16,18(25),19(24),20,22-dodecaene-13,9'-fluorene].
| Compound Name | 5,21-ditert-butylspiro[2,24-diazoniaheptacyclo[12.10.1.11,8.02,7.018,25.019,24.012,26]hexacosa-2(7),3,5,8(26),9,11,14,16,18(25),19(24),20,22-dodecaene-13,9'-fluorene] |
|---|---|
| PubChem CID | 161175068 |
| Molecular Formula | C44H38N2+2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 5,21-ditert-butylspiro[2,24-diazoniaheptacyclo[12.10.1.11,8.02,7.018,25.019,24.012,26]hexacosa-2(7),3,5,8(26),9,11,14,16,18(25),19(24),20,22-dodecaene-13,9'-fluorene] |
| SMILES | CC(C)(C)c1cc[n+]2c(c1)-c1cccc3c1C21c2c(cccc2C32c3ccccc3-c3ccccc32)-c2cc(C(C)(C)C)cc[n+]21 |
| InChI | InChI=1S/C44H38N2/c1-41(2,3)27-21-23-45-37(25-27)31-15-11-19-35-39(31)44(45)40-32(38-26-28(42(4,5)6)22-24-46(38)44)16-12-20-36(40)43(35)33-17-9-7-13-29(33)30-14-8-10-18-34(30)43/h7-26H,1-6H3/q+2 |
| InChIKey | ZTZWQMKLKKLZRH-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|