About lithium;propan-2-ol;iodide
lithium;propan-2-ol;iodide (PubChem CID 161175112) has the molecular formula C3H8ILiO
and a molecular weight of 193.94 g/mol. Its IUPAC name is lithium;propan-2-ol;iodide.
Molecular Properties
| Compound Name | lithium;propan-2-ol;iodide |
| PubChem CID | 161175112 |
| Molecular Formula | C3H8ILiO |
| Molecular Weight | 193.94 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | lithium;propan-2-ol;iodide |
| SMILES | CC(C)O.[I-].[Li+] |
| InChI | InChI=1S/C3H8O.HI.Li/c1-3(2)4;;/h3-4H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | URRVAVSBNULKRC-UHFFFAOYSA-M |
| XLogP | -5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.94 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze lithium;propan-2-ol;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;propan-2-ol;iodide?
The IUPAC name of lithium;propan-2-ol;iodide (CID 161175112) is lithium;propan-2-ol;iodide.
What is the SMILES notation for lithium;propan-2-ol;iodide?
The canonical SMILES for lithium;propan-2-ol;iodide is CC(C)O.[I-].[Li+].
What is the InChIKey of lithium;propan-2-ol;iodide?
The InChIKey is URRVAVSBNULKRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O.HI.Li/c1-3(2)4;;/h3-4H,1-2H3;1H;/q;;+1/p-1.
What are the key properties of lithium;propan-2-ol;iodide?
lithium;propan-2-ol;iodide has a molecular weight of 193.94 g/mol, XLogP of -5.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;propan-2-ol;iodide is sourced from PubChem (CID 161175112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).