C13H21N3 — CID 161179735
1-(6,6-dimethylhept-4-ynyl)-4-ethyltriazole (PubChem CID 161179735) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(6,6-dimethylhept-4-ynyl)-4-ethyltriazole.
| Compound Name | 1-(6,6-dimethylhept-4-ynyl)-4-ethyltriazole |
|---|---|
| PubChem CID | 161179735 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-(6,6-dimethylhept-4-ynyl)-4-ethyltriazole |
| SMILES | CCc1cn(CCCC#CC(C)(C)C)nn1 |
| InChI | InChI=1S/C13H21N3/c1-5-12-11-16(15-14-12)10-8-6-7-9-13(2,3)4/h11H,5-6,8,10H2,1-4H3 |
| InChIKey | WSNNJZPODGKTRG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|