C28H26F3N4O3S- — CID 161184306
N-[3-[(2R)-1-[6-(3-aminophenyl)pyrazin-2-yl]propan-2-yl]phenyl]-3-(trifluoromethyl)benzamide;methanesulfinate (PubChem CID 161184306) has the molecular formula C28H26F3N4O3S- and a molecular weight of 555.60 g/mol. Its IUPAC name is N-[3-[(2R)-1-[6-(3-aminophenyl)pyrazin-2-yl]propan-2-yl]phenyl]-3-(trifluoromethyl)benzamide;methanesulfinate.
| Compound Name | N-[3-[(2R)-1-[6-(3-aminophenyl)pyrazin-2-yl]propan-2-yl]phenyl]-3-(trifluoromethyl)benzamide;methanesulfinate |
|---|---|
| PubChem CID | 161184306 |
| Molecular Formula | C28H26F3N4O3S- |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-[3-[(2R)-1-[6-(3-aminophenyl)pyrazin-2-yl]propan-2-yl]phenyl]-3-(trifluoromethyl)benzamide;methanesulfinate |
| SMILES | CS(=O)[O-].C[C@H](Cc1cncc(-c2cccc(N)c2)n1)c1cccc(NC(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H23F3N4O.CH4O2S/c1-17(11-24-15-32-16-25(33-24)19-6-3-9-22(31)13-19)18-5-4-10-23(14-18)34-26(35)20-7-2-8-21(12-20)27(28,29)30;1-4(2)3/h2-10,12-17H,11,31H2,1H3,(H,34,35);1H3,(H,2,3)/p-1/t17-;/m1./s1 |
| InChIKey | FMRRPSOIQXFTPY-UNTBIKODSA-M |
| XLogP | 5.84 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|