C40H78O3 — CID 161186947
11-hydroxy-10-methylnonadecan-2-one;(E)-10-methylnonadec-11-en-2-one (PubChem CID 161186947) has the molecular formula C40H78O3 and a molecular weight of 607.06 g/mol. Its IUPAC name is 11-hydroxy-10-methylnonadecan-2-one;(E)-10-methylnonadec-11-en-2-one.
| Compound Name | 11-hydroxy-10-methylnonadecan-2-one;(E)-10-methylnonadec-11-en-2-one |
|---|---|
| PubChem CID | 161186947 |
| Molecular Formula | C40H78O3 |
| Molecular Weight | 607.06 g/mol |
| Exact Mass | 606.60 |
| IUPAC Name | 11-hydroxy-10-methylnonadecan-2-one;(E)-10-methylnonadec-11-en-2-one |
| SMILES | CCCCCCC/C=C/C(C)CCCCCCCC(C)=O.CCCCCCCCC(O)C(C)CCCCCCCC(C)=O |
| InChI | InChI=1S/C20H40O2.C20H38O/c1-4-5-6-7-11-14-17-20(22)18(2)15-12-9-8-10-13-16-19(3)21;1-4-5-6-7-8-10-13-16-19(2)17-14-11-9-12-15-18-20(3)21/h18,20,22H,4-17H2,1-3H3;13,16,19H,4-12,14-15,17-18H2,1-3H3/b;16-13+ |
| InChIKey | UTEZLJJWGTWGRC-MDPUXWEUSA-N |
| XLogP | 12.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.06 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|