C20H36O3 — CID 56834597
(3R,4R,6R,9R,10R,13S)-4,10-dihydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradecan-1-one (PubChem CID 56834597) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (3R,4R,6R,9R,10R,13S)-4,10-dihydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradecan-1-one.
| Compound Name | (3R,4R,6R,9R,10R,13S)-4,10-dihydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradecan-1-one |
|---|---|
| PubChem CID | 56834597 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (3R,4R,6R,9R,10R,13S)-4,10-dihydroxy-3,9,13-trimethyl-6-prop-1-en-2-ylcyclotetradecan-1-one |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@H](O)CC[C@H](C)CC(=O)C[C@@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C20H36O3/c1-13(2)17-8-7-15(4)19(22)9-6-14(3)10-18(21)11-16(5)20(23)12-17/h14-17,19-20,22-23H,1,6-12H2,2-5H3/t14-,15+,16+,17+,19+,20+/m0/s1 |
| InChIKey | DDBLDAGSFDWDCS-CETRPMQOSA-N |
| XLogP | 4.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|