C25H19ClFN3OS — CID 161201011
O-(4-fluorophenyl) 6-chloro-1-(4-cyanophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate;molecular hydrogen (PubChem CID 161201011) has the molecular formula C25H19ClFN3OS and a molecular weight of 463.97 g/mol. Its IUPAC name is O-(4-fluorophenyl) 6-chloro-1-(4-cyanophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate;molecular hydrogen.
| Compound Name | O-(4-fluorophenyl) 6-chloro-1-(4-cyanophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate;molecular hydrogen |
|---|---|
| PubChem CID | 161201011 |
| Molecular Formula | C25H19ClFN3OS |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | O-(4-fluorophenyl) 6-chloro-1-(4-cyanophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate;molecular hydrogen |
| SMILES | N#Cc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=S)Oc2ccc(F)cc2)cc1.[H][H] |
| InChI | InChI=1S/C25H17ClFN3OS.H2/c26-17-5-10-22-21(13-17)20-11-12-30(25(32)31-19-8-6-18(27)7-9-19)24(23(20)29-22)16-3-1-15(14-28)2-4-16;/h1-10,13,24,29H,11-12H2;1H |
| InChIKey | UUYZXXBXVVPABB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|