C28H28ClN3O2S — CID 143111475
O-phenyl 6-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate (PubChem CID 143111475) has the molecular formula C28H28ClN3O2S and a molecular weight of 506.07 g/mol. Its IUPAC name is O-phenyl 6-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate.
| Compound Name | O-phenyl 6-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate |
|---|---|
| PubChem CID | 143111475 |
| Molecular Formula | C28H28ClN3O2S |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | O-phenyl 6-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioate |
| SMILES | CN(C)CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=S)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28ClN3O2S/c1-31(2)16-17-33-21-11-8-19(9-12-21)27-26-23(24-18-20(29)10-13-25(24)30-26)14-15-32(27)28(35)34-22-6-4-3-5-7-22/h3-13,18,27,30H,14-17H2,1-2H3 |
| InChIKey | PHARSWSHUXZXFZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|