C11H17F7O5S — CID 161208498
2-[3-(5,5-difluorohexan-3-yloxy)-1,1,1-trifluoropropan-2-yl]oxy-2,2-difluoroethanesulfonic acid (PubChem CID 161208498) has the molecular formula C11H17F7O5S and a molecular weight of 394.31 g/mol. Its IUPAC name is 2-[3-(5,5-difluorohexan-3-yloxy)-1,1,1-trifluoropropan-2-yl]oxy-2,2-difluoroethanesulfonic acid.
| Compound Name | 2-[3-(5,5-difluorohexan-3-yloxy)-1,1,1-trifluoropropan-2-yl]oxy-2,2-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 161208498 |
| Molecular Formula | C11H17F7O5S |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[3-(5,5-difluorohexan-3-yloxy)-1,1,1-trifluoropropan-2-yl]oxy-2,2-difluoroethanesulfonic acid |
| SMILES | CCC(CC(C)(F)F)OCC(OC(F)(F)CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H17F7O5S/c1-3-7(4-9(2,12)13)22-5-8(11(16,17)18)23-10(14,15)6-24(19,20)21/h7-8H,3-6H2,1-2H3,(H,19,20,21) |
| InChIKey | UVXQBPHVRIROKS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|