C21H17NO5S4 — CID 161212589
3-hydroxybenzaldehyde;(5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;5-sulfanylidenethiolan-3-one (PubChem CID 161212589) has the molecular formula C21H17NO5S4 and a molecular weight of 491.64 g/mol. Its IUPAC name is 3-hydroxybenzaldehyde;(5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;5-sulfanylidenethiolan-3-one.
| Compound Name | 3-hydroxybenzaldehyde;(5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;5-sulfanylidenethiolan-3-one |
|---|---|
| PubChem CID | 161212589 |
| Molecular Formula | C21H17NO5S4 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 3-hydroxybenzaldehyde;(5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;5-sulfanylidenethiolan-3-one |
| SMILES | O=C1CSC(=S)C1.O=C1NC(=S)S/C1=C\c1cccc(O)c1.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C10H7NO2S2.C7H6O2.C4H4OS2/c12-7-3-1-2-6(4-7)5-8-9(13)11-10(14)15-8;8-5-6-2-1-3-7(9)4-6;5-3-1-4(6)7-2-3/h1-5,12H,(H,11,13,14);1-5,9H;1-2H2/b8-5-;; |
| InChIKey | UWKXSEGTKACODD-XTKZWJJBSA-N |
| XLogP | 4.11 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|