C11H24Cl2N4O5 — CID 161219334
(2S)-2-amino-6-[hydroxy-[C-methyl-N-(methylcarbamoyloxymethyl)carbonimidoyl]amino]hexanoic acid;dihydrochloride (PubChem CID 161219334) has the molecular formula C11H24Cl2N4O5 and a molecular weight of 363.24 g/mol. Its IUPAC name is (2S)-2-amino-6-[hydroxy-[C-methyl-N-(methylcarbamoyloxymethyl)carbonimidoyl]amino]hexanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-6-[hydroxy-[C-methyl-N-(methylcarbamoyloxymethyl)carbonimidoyl]amino]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 161219334 |
| Molecular Formula | C11H24Cl2N4O5 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2S)-2-amino-6-[hydroxy-[C-methyl-N-(methylcarbamoyloxymethyl)carbonimidoyl]amino]hexanoic acid;dihydrochloride |
| SMILES | CNC(=O)OCN=C(C)N(O)CCCC[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C11H22N4O5.2ClH/c1-8(14-7-20-11(18)13-2)15(19)6-4-3-5-9(12)10(16)17;;/h9,19H,3-7,12H2,1-2H3,(H,13,18)(H,16,17);2*1H/t9-;;/m0../s1 |
| InChIKey | KXNIWNOJPQGQPJ-WWPIYYJJSA-N |
| XLogP | 0.84 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|