C12H21N3O8 — CID 73433422
2-amino-6-[methoxycarbonyloxy-(N-methoxycarbonyloxy-C-methylcarbonimidoyl)amino]hexanoic acid (PubChem CID 73433422) has the molecular formula C12H21N3O8 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-amino-6-[methoxycarbonyloxy-(N-methoxycarbonyloxy-C-methylcarbonimidoyl)amino]hexanoic acid.
| Compound Name | 2-amino-6-[methoxycarbonyloxy-(N-methoxycarbonyloxy-C-methylcarbonimidoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 73433422 |
| Molecular Formula | C12H21N3O8 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-amino-6-[methoxycarbonyloxy-(N-methoxycarbonyloxy-C-methylcarbonimidoyl)amino]hexanoic acid |
| SMILES | COC(=O)ON=C(C)N(CCCCC(N)C(=O)O)OC(=O)OC |
| InChI | InChI=1S/C12H21N3O8/c1-8(14-22-11(18)20-2)15(23-12(19)21-3)7-5-4-6-9(13)10(16)17/h9H,4-7,13H2,1-3H3,(H,16,17) |
| InChIKey | YKCJRBNZWJSWCL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|