C12H23Cl2N3O6S2 — CID 172922012
(2S)-2-amino-6-[[(E)-C-methyl-N-methylsulfanylcarbonyloxycarbonimidoyl]-methylsulfanylcarbonyloxyamino]hexanoic acid;dihydrochloride (PubChem CID 172922012) has the molecular formula C12H23Cl2N3O6S2 and a molecular weight of 440.37 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(E)-C-methyl-N-methylsulfanylcarbonyloxycarbonimidoyl]-methylsulfanylcarbonyloxyamino]hexanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-6-[[(E)-C-methyl-N-methylsulfanylcarbonyloxycarbonimidoyl]-methylsulfanylcarbonyloxyamino]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 172922012 |
| Molecular Formula | C12H23Cl2N3O6S2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (2S)-2-amino-6-[[(E)-C-methyl-N-methylsulfanylcarbonyloxycarbonimidoyl]-methylsulfanylcarbonyloxyamino]hexanoic acid;dihydrochloride |
| SMILES | CSC(=O)O/N=C(\C)N(CCCC[C@H](N)C(=O)O)OC(=O)SC.Cl.Cl |
| InChI | InChI=1S/C12H21N3O6S2.2ClH/c1-8(14-20-11(18)22-2)15(21-12(19)23-3)7-5-4-6-9(13)10(16)17;;/h9H,4-7,13H2,1-3H3,(H,16,17);2*1H/b14-8+;;/t9-;;/m0../s1 |
| InChIKey | MRVWTNJESVVWKO-PFUJHTTISA-N |
| XLogP | 2.96 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|