C7H18Cl2N4O3 — CID 24787823
(2S)-2-amino-5-[[(E)-N'-hydroxycarbamimidoyl]-methylamino]pentanoic acid;dihydrochloride (PubChem CID 24787823) has the molecular formula C7H18Cl2N4O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(E)-N'-hydroxycarbamimidoyl]-methylamino]pentanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-5-[[(E)-N'-hydroxycarbamimidoyl]-methylamino]pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 24787823 |
| Molecular Formula | C7H18Cl2N4O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2S)-2-amino-5-[[(E)-N'-hydroxycarbamimidoyl]-methylamino]pentanoic acid;dihydrochloride |
| SMILES | CN(CCC[C@H](N)C(=O)O)/C(N)=N/O.Cl.Cl |
| InChI | InChI=1S/C7H16N4O3.2ClH/c1-11(7(9)10-14)4-2-3-5(8)6(12)13;;/h5,14H,2-4,8H2,1H3,(H2,9,10)(H,12,13);2*1H/t5-;;/m0../s1 |
| InChIKey | DMMHXSLSMLQNIO-XRIGFGBMSA-N |
| XLogP | -0.34 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|