C9H21AcCl2N3O4 — CID 172971627
actinium;(2S)-2-amino-6-[hydroxymethyl-[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride (PubChem CID 172971627) has the molecular formula C9H21AcCl2N3O4 and a molecular weight of 533.19 g/mol. Its IUPAC name is actinium;(2S)-2-amino-6-[hydroxymethyl-[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride.
| Compound Name | actinium;(2S)-2-amino-6-[hydroxymethyl-[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 172971627 |
| Molecular Formula | C9H21AcCl2N3O4 |
| Molecular Weight | 533.19 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | actinium;(2S)-2-amino-6-[hydroxymethyl-[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride |
| SMILES | C/C(=N\O)N(CO)CCCC[C@H](N)C(=O)O.Cl.Cl.[Ac] |
| InChI | InChI=1S/C9H19N3O4.Ac.2ClH/c1-7(11-16)12(6-13)5-3-2-4-8(10)9(14)15;;;/h8,13,16H,2-6,10H2,1H3,(H,14,15);;2*1H/b11-7+;;;/t8-;;;/m0.../s1 |
| InChIKey | LXISUDMQOGIGRL-UUQDHEQPSA-N |
| XLogP | 0.47 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|