C27H34N6S2 — CID 161221601
[[[3-[N-(carbamothioylamino)-C-phenylcarbonimidoyl]-5-methylphenyl]-phenylmethylidene]amino]thiourea;ethane (PubChem CID 161221601) has the molecular formula C27H34N6S2 and a molecular weight of 506.75 g/mol. Its IUPAC name is [[[3-[N-(carbamothioylamino)-C-phenylcarbonimidoyl]-5-methylphenyl]-phenylmethylidene]amino]thiourea;ethane.
| Compound Name | [[[3-[N-(carbamothioylamino)-C-phenylcarbonimidoyl]-5-methylphenyl]-phenylmethylidene]amino]thiourea;ethane |
|---|---|
| PubChem CID | 161221601 |
| Molecular Formula | C27H34N6S2 |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [[[3-[N-(carbamothioylamino)-C-phenylcarbonimidoyl]-5-methylphenyl]-phenylmethylidene]amino]thiourea;ethane |
| SMILES | CC.CC.Cc1cc(C(=NNC(N)=S)c2ccccc2)cc(C(=NNC(N)=S)c2ccccc2)c1 |
| InChI | InChI=1S/C23H22N6S2.2C2H6/c1-15-12-18(20(26-28-22(24)30)16-8-4-2-5-9-16)14-19(13-15)21(27-29-23(25)31)17-10-6-3-7-11-17;2*1-2/h2-14H,1H3,(H3,24,28,30)(H3,25,29,31);2*1-2H3 |
| InChIKey | UXOVTASIBRJNBP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|