C11H15N2O3PS2 — CID 161222283
dihydroxy-[(2-propan-2-yl-6-prop-2-ynoxypyrimidin-4-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane (PubChem CID 161222283) has the molecular formula C11H15N2O3PS2 and a molecular weight of 318.36 g/mol. Its IUPAC name is dihydroxy-[(2-propan-2-yl-6-prop-2-ynoxypyrimidin-4-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxy-[(2-propan-2-yl-6-prop-2-ynoxypyrimidin-4-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 161222283 |
| Molecular Formula | C11H15N2O3PS2 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | dihydroxy-[(2-propan-2-yl-6-prop-2-ynoxypyrimidin-4-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
| SMILES | C#CCOc1cc(CSP(O)(O)=S)nc(C(C)C)n1 |
| InChI | InChI=1S/C11H15N2O3PS2/c1-4-5-16-10-6-9(7-19-17(14,15)18)12-11(13-10)8(2)3/h1,6,8H,5,7H2,2-3H3,(H2,14,15,18) |
| InChIKey | UXRDUMYLCRHSMP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|