C43H46N4O6 — CID 161242622
N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-N-[4-[1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-8-oxononanamide (PubChem CID 161242622) has the molecular formula C43H46N4O6 and a molecular weight of 714.86 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-N-[4-[1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-8-oxononanamide.
| Compound Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-N-[4-[1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-8-oxononanamide |
|---|---|
| PubChem CID | 161242622 |
| Molecular Formula | C43H46N4O6 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-N-[4-[1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-8-oxononanamide |
| SMILES | CC(=O)CCCCCCC(=O)N(C[C@@H]1COC(C)(C)O1)c1ccc(C(C(=O)Cc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C43H46N4O6/c1-29(48)12-6-4-5-7-19-38(50)47(27-35-28-52-43(2,3)53-35)34-22-20-30(21-23-34)39(37(49)26-33-15-8-13-31-16-10-24-44-40(31)33)42(51)46-36-18-9-14-32-17-11-25-45-41(32)36/h8-11,13-18,20-25,35,39H,4-7,12,19,26-28H2,1-3H3,(H,46,51)/t35-,39?/m1/s1 |
| InChIKey | GIEBRNULDATXKZ-QQKHLPPFSA-N |
| XLogP | 7.73 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|