C9H11N3O — CID 161242788
3-imidazol-1-yl-5-prop-1-en-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 161242788) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-imidazol-1-yl-5-prop-1-en-2-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-imidazol-1-yl-5-prop-1-en-2-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 161242788 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 3-imidazol-1-yl-5-prop-1-en-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | C=C(C)C1CC(n2ccnc2)=NO1 |
| InChI | InChI=1S/C9H11N3O/c1-7(2)8-5-9(11-13-8)12-4-3-10-6-12/h3-4,6,8H,1,5H2,2H3 |
| InChIKey | VAFTWCSQRGBLMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|