C14H15N3O2 — CID 167086129
4-imidazol-1-yl-2,6-bis(3-methyloxiran-2-yl)pyridine (PubChem CID 167086129) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-imidazol-1-yl-2,6-bis(3-methyloxiran-2-yl)pyridine.
| Compound Name | 4-imidazol-1-yl-2,6-bis(3-methyloxiran-2-yl)pyridine |
|---|---|
| PubChem CID | 167086129 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-imidazol-1-yl-2,6-bis(3-methyloxiran-2-yl)pyridine |
| SMILES | CC1OC1c1cc(-n2ccnc2)cc(C2OC2C)n1 |
| InChI | InChI=1S/C14H15N3O2/c1-8-13(18-8)11-5-10(17-4-3-15-7-17)6-12(16-11)14-9(2)19-14/h3-9,13-14H,1-2H3 |
| InChIKey | NOEMQETYQTTZSA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|