About 3-imidazol-1-yl-5,6-dihydro-4H-oxazine
3-imidazol-1-yl-5,6-dihydro-4H-oxazine (PubChem CID 67639318) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3-imidazol-1-yl-5,6-dihydro-4H-oxazine.
Molecular Properties
| Compound Name | 3-imidazol-1-yl-5,6-dihydro-4H-oxazine |
| PubChem CID | 67639318 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3-imidazol-1-yl-5,6-dihydro-4H-oxazine |
| SMILES | c1cn(C2=NOCCC2)cn1 |
| InChI | InChI=1S/C7H9N3O/c1-2-7(9-11-5-1)10-4-3-8-6-10/h3-4,6H,1-2,5H2 |
| InChIKey | QTNHOSHABGHJME-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-imidazol-1-yl-5,6-dihydro-4H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-yl-5,6-dihydro-4H-oxazine?
The IUPAC name of 3-imidazol-1-yl-5,6-dihydro-4H-oxazine (CID 67639318) is 3-imidazol-1-yl-5,6-dihydro-4H-oxazine.
What is the SMILES notation for 3-imidazol-1-yl-5,6-dihydro-4H-oxazine?
The canonical SMILES for 3-imidazol-1-yl-5,6-dihydro-4H-oxazine is c1cn(C2=NOCCC2)cn1.
What is the InChIKey of 3-imidazol-1-yl-5,6-dihydro-4H-oxazine?
The InChIKey is QTNHOSHABGHJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-2-7(9-11-5-1)10-4-3-8-6-10/h3-4,6H,1-2,5H2.
What are the key properties of 3-imidazol-1-yl-5,6-dihydro-4H-oxazine?
3-imidazol-1-yl-5,6-dihydro-4H-oxazine has a molecular weight of 151.17 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-yl-5,6-dihydro-4H-oxazine is sourced from PubChem (CID 67639318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).