C42H30N4O4S2 — CID 161250694
4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-amine;1-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]pyrrolidine-2,5-dione (PubChem CID 161250694) has the molecular formula C42H30N4O4S2 and a molecular weight of 718.86 g/mol. Its IUPAC name is 4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-amine;1-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-amine;1-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 161250694 |
| Molecular Formula | C42H30N4O4S2 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-amine;1-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]pyrrolidine-2,5-dione |
| SMILES | Nc1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1.O=C1CCC(=O)N1c1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C23H16N2O3S.C19H14N2OS/c26-21-10-11-22(27)25(21)23-12-18-19(13-24-14-20(18)29-23)28-17-8-6-16(7-9-17)15-4-2-1-3-5-15;20-19-10-16-17(11-21-12-18(16)23-19)22-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12-14H,10-11H2;1-12H,20H2 |
| InChIKey | VBFPZVHGNWFYHJ-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|