About ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol
ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol (PubChem CID 161264919) has the molecular formula C28H32O4
and a molecular weight of 432.56 g/mol. Its IUPAC name is ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol.
Molecular Properties
| Compound Name | ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol |
| PubChem CID | 161264919 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol |
| SMILES | C=COCC.CCOC(C)Oc1cccc2ccccc12.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C14H16O2.C10H8O.C4H8O/c1-3-15-11(2)16-14-10-6-8-12-7-4-5-9-13(12)14;11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-4-2/h4-11H,3H2,1-2H3;1-7,11H;3H,1,4H2,2H3 |
| InChIKey | VDAYHIABQYYCSR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol?
The IUPAC name of ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol (CID 161264919) is ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol.
What is the SMILES notation for ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol?
The canonical SMILES for ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol is C=COCC.CCOC(C)Oc1cccc2ccccc12.Oc1cccc2ccccc12.
What is the InChIKey of ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol?
The InChIKey is VDAYHIABQYYCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2.C10H8O.C4H8O/c1-3-15-11(2)16-14-10-6-8-12-7-4-5-9-13(12)14;11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-4-2/h4-11H,3H2,1-2H3;1-7,11H;3H,1,4H2,2H3.
What are the key properties of ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol?
ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol has a molecular weight of 432.56 g/mol, XLogP of 7.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethane;1-(1-ethoxyethoxy)naphthalene;naphthalen-1-ol is sourced from PubChem (CID 161264919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).