C47H45BO3 — CID 161287571
10-[2,6-dimethyl-3-[4-methyl-3-[9-methyl-9-(trideuteriomethyl)xanthen-4-yl]-2-(trideuteriomethyl)phenyl]phenyl]-6,12,12-trimethylbenzo[c][1,5,2]benzodioxaborocine (PubChem CID 161287571) has the molecular formula C47H45BO3 and a molecular weight of 674.72 g/mol. Its IUPAC name is 10-[2,6-dimethyl-3-[4-methyl-3-[9-methyl-9-(trideuteriomethyl)xanthen-4-yl]-2-(trideuteriomethyl)phenyl]phenyl]-6,12,12-trimethylbenzo[c][1,5,2]benzodioxaborocine.
| Compound Name | 10-[2,6-dimethyl-3-[4-methyl-3-[9-methyl-9-(trideuteriomethyl)xanthen-4-yl]-2-(trideuteriomethyl)phenyl]phenyl]-6,12,12-trimethylbenzo[c][1,5,2]benzodioxaborocine |
|---|---|
| PubChem CID | 161287571 |
| Molecular Formula | C47H45BO3 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.38 |
| IUPAC Name | 10-[2,6-dimethyl-3-[4-methyl-3-[9-methyl-9-(trideuteriomethyl)xanthen-4-yl]-2-(trideuteriomethyl)phenyl]phenyl]-6,12,12-trimethylbenzo[c][1,5,2]benzodioxaborocine |
| SMILES | [2H]C([2H])([2H])c1c(-c2ccc(C)c(-c3cccc4c3OC(C)(C)c3ccccc3OB4C)c2C)ccc(C)c1-c1cccc2c1Oc1ccccc1C2(C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C47H45BO3/c1-28-24-26-32(30(3)42(28)34-16-14-20-38-44(34)49-40-22-12-10-18-36(40)46(38,5)6)33-27-25-29(2)43(31(33)4)35-17-15-21-39-45(35)50-47(7,8)37-19-11-13-23-41(37)51-48(39)9/h10-27H,1-9H3/i3D3,5D3 |
| InChIKey | MNCRFVFKKOSOAT-OVJRARTCSA-N |
| XLogP | 11.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|