C39H43NO7S3 — CID 161302489
3-ethyl-2-[(1E,3E,5Z)-5-(4-ethyl-1,1,6-trimethyl-8-sulfino-3H-cyclopenta[a]naphthalen-2-ylidene)penta-1,3-dienyl]-1,1-dimethyl-2H-benzo[e]indole-8-sulfinic acid;sulfur trioxide (PubChem CID 161302489) has the molecular formula C39H43NO7S3 and a molecular weight of 733.97 g/mol. Its IUPAC name is 3-ethyl-2-[(1E,3E,5Z)-5-(4-ethyl-1,1,6-trimethyl-8-sulfino-3H-cyclopenta[a]naphthalen-2-ylidene)penta-1,3-dienyl]-1,1-dimethyl-2H-benzo[e]indole-8-sulfinic acid;sulfur trioxide.
| Compound Name | 3-ethyl-2-[(1E,3E,5Z)-5-(4-ethyl-1,1,6-trimethyl-8-sulfino-3H-cyclopenta[a]naphthalen-2-ylidene)penta-1,3-dienyl]-1,1-dimethyl-2H-benzo[e]indole-8-sulfinic acid;sulfur trioxide |
|---|---|
| PubChem CID | 161302489 |
| Molecular Formula | C39H43NO7S3 |
| Molecular Weight | 733.97 g/mol |
| Exact Mass | 733.22 |
| IUPAC Name | 3-ethyl-2-[(1E,3E,5Z)-5-(4-ethyl-1,1,6-trimethyl-8-sulfino-3H-cyclopenta[a]naphthalen-2-ylidene)penta-1,3-dienyl]-1,1-dimethyl-2H-benzo[e]indole-8-sulfinic acid;sulfur trioxide |
| SMILES | CCc1cc2c(C)cc(S(=O)O)cc2c2c1C/C(=C/C=C/C=C/C1N(CC)c3ccc4ccc(S(=O)O)cc4c3C1(C)C)C2(C)C.O=S(=O)=O |
| InChI | InChI=1S/C39H43NO4S2.O3S/c1-8-25-20-30-24(3)19-29(46(43)44)23-33(30)36-31(25)21-27(38(36,4)5)13-11-10-12-14-35-39(6,7)37-32-22-28(45(41)42)17-15-26(32)16-18-34(37)40(35)9-2;1-4(2)3/h10-20,22-23,35H,8-9,21H2,1-7H3,(H,41,42)(H,43,44);/b11-10+,14-12+,27-13-; |
| InChIKey | VHUOTLOZCQPJCN-DXLJHQAOSA-N |
| XLogP | 8.08 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.97 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|