C36H32BBr3N2O6 — CID 161304709
4-(5-bromo-2-nitrophenyl)-1H-indene;2,4-dibromo-1-nitrobenzene;2-(1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 161304709) has the molecular formula C36H32BBr3N2O6 and a molecular weight of 839.18 g/mol. Its IUPAC name is 4-(5-bromo-2-nitrophenyl)-1H-indene;2,4-dibromo-1-nitrobenzene;2-(1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 4-(5-bromo-2-nitrophenyl)-1H-indene;2,4-dibromo-1-nitrobenzene;2-(1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 161304709 |
| Molecular Formula | C36H32BBr3N2O6 |
| Molecular Weight | 839.18 g/mol |
| Exact Mass | 835.99 |
| IUPAC Name | 4-(5-bromo-2-nitrophenyl)-1H-indene;2,4-dibromo-1-nitrobenzene;2-(1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc3c2C=CC3)OC1(C)C.O=[N+]([O-])c1ccc(Br)cc1-c1cccc2c1C=CC2.O=[N+]([O-])c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H19BO2.C15H10BrNO2.C6H3Br2NO2/c1-14(2)15(3,4)18-16(17-14)13-10-6-8-11-7-5-9-12(11)13;16-11-7-8-15(17(18)19)14(9-11)13-6-2-4-10-3-1-5-12(10)13;7-4-1-2-6(9(10)11)5(8)3-4/h5-6,8-10H,7H2,1-4H3;1-2,4-9H,3H2;1-3H |
| InChIKey | VICBNAIDABJJLF-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.18 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|