C24H35N5O2S — CID 161306758
5-(4-tert-butylphenyl)-2H-tetrazole;4-tert-butyl-N-propylbenzenesulfonamide (PubChem CID 161306758) has the molecular formula C24H35N5O2S and a molecular weight of 457.64 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2H-tetrazole;4-tert-butyl-N-propylbenzenesulfonamide.
| Compound Name | 5-(4-tert-butylphenyl)-2H-tetrazole;4-tert-butyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 161306758 |
| Molecular Formula | C24H35N5O2S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2H-tetrazole;4-tert-butyl-N-propylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(-c2nn[nH]n2)cc1.CCCNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H21NO2S.C11H14N4/c1-5-10-14-17(15,16)12-8-6-11(7-9-12)13(2,3)4;1-11(2,3)9-6-4-8(5-7-9)10-12-14-15-13-10/h6-9,14H,5,10H2,1-4H3;4-7H,1-3H3,(H,12,13,14,15) |
| InChIKey | VIISIUKVJCYKRP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |